EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | C=C(C)C(CO)CC=C(C)C |
| InChI | InChI=1S/C10H18O/c1-8(2)5-6-10(7-11)9(3)4/h5,10-11H,3,6-7H2,1-2,4H3 |
| InChIKey | CZVXBFUKBZRMKR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lavandulol (CHEBI:50281) has role fragrance (CHEBI:48318) |
| lavandulol (CHEBI:50281) has role pheromone (CHEBI:26013) |
| lavandulol (CHEBI:50281) has role plant metabolite (CHEBI:76924) |
| lavandulol (CHEBI:50281) is a monoterpenoid (CHEBI:25409) |
| lavandulol (CHEBI:50281) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| lavandulyl diphosphate (CHEBI:50284) has functional parent lavandulol (CHEBI:50281) |
| (R)-lavandulol (CHEBI:50283) is a lavandulol (CHEBI:50281) |
| (S)-lavandulol (CHEBI:50282) is a lavandulol (CHEBI:50281) |
| IUPAC Name |
|---|
| 5-methyl-2-(prop-1-en-2-yl)hex-4-en-1-ol |
| Synonym | Source |
|---|---|
| 5-methyl-2-(1-methylethenyl)hex-4-en-1-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| lavandulol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CN101988028 | Patent |
| GB1495064 | Patent |
| Lavandulol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1758907 | Reaxys |
| CAS:498-16-8 | NIST Chemistry WebBook |
| Citations |
|---|