EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N3O3S |
| Net Charge | 0 |
| Average Mass | 345.424 |
| Monoisotopic Mass | 345.11471 |
| SMILES | COc1ccc2nc([S@@](=O)Cc3ncc(C)c(OC)c3C)nc2c1 |
| InChI | InChI=1S/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20)/t24-/m0/s1 |
| InChIKey | SUBDBMMJDZJVOS-DEOSSOPVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that inhibits H+/K+-exchanging ATPase, EC 3.6.3.10. Such compounds are also known as proton pump inhibitors. EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| esomeprazole (CHEBI:50275) has role anti-ulcer drug (CHEBI:49201) |
| esomeprazole (CHEBI:50275) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| esomeprazole (CHEBI:50275) has role EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor (CHEBI:49200) |
| esomeprazole (CHEBI:50275) has role histamine antagonist (CHEBI:37956) |
| esomeprazole (CHEBI:50275) is a 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole (CHEBI:77260) |
| esomeprazole (CHEBI:50275) is conjugate acid of esomeprazole(1−) (CHEBI:77264) |
| esomeprazole (CHEBI:50275) is enantiomer of (R)-omeprazole (CHEBI:77262) |
| Incoming Relation(s) |
| omeprazole (CHEBI:7772) has part esomeprazole (CHEBI:50275) |
| esomeprazole(1−) (CHEBI:77264) is conjugate base of esomeprazole (CHEBI:50275) |
| (R)-omeprazole (CHEBI:77262) is enantiomer of esomeprazole (CHEBI:50275) |
| IUPAC Name |
|---|
| 5-methoxy-2-{(S)-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole |
| INNs | Source |
|---|---|
| esomeprazol | ChEBI |
| esomeprazole | ChemIDplus |
| ésoméprazole | WHO MedNet |
| esomeprazolum | ChEBI |
| Synonyms | Source |
|---|---|
| (S)-(−)-omeprazole | ChemIDplus |
| (S)-omeprazole | ChemIDplus |
| (−)-omeprazole | ChemIDplus |
| Brand Names | Source |
|---|---|
| Alenia | ChemIDplus |
| Escz | ChemIDplus |
| Esofag | ChemIDplus |
| Inexium paranova | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1055 | DrugCentral |
| D07917 | KEGG DRUG |
| DB00736 | DrugBank |
| Esomeprazole | Wikipedia |
| HMDB0005009 | HMDB |
| HMDB0014874 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12060639 | Reaxys |
| CAS:119141-88-7 | ChemIDplus |
| Citations |
|---|