EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N3O3S |
| Net Charge | 0 |
| Average Mass | 345.424 |
| Monoisotopic Mass | 345.11471 |
| SMILES | COc1ccc2nc([S@@](=O)Cc3ncc(C)c(OC)c3C)nc2c1 |
| InChI | InChI=1S/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20)/t24-/m0/s1 |
| InChIKey | SUBDBMMJDZJVOS-DEOSSOPVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that inhibits H+/K+-exchanging ATPase, EC 3.6.3.10. Such compounds are also known as proton pump inhibitors. EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). |
| Applications: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| esomeprazole (CHEBI:50275) has role anti-ulcer drug (CHEBI:49201) |
| esomeprazole (CHEBI:50275) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| esomeprazole (CHEBI:50275) has role EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor (CHEBI:49200) |
| esomeprazole (CHEBI:50275) has role histamine antagonist (CHEBI:37956) |
| esomeprazole (CHEBI:50275) is a 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole (CHEBI:77260) |
| esomeprazole (CHEBI:50275) is conjugate acid of esomeprazole(1−) (CHEBI:77264) |
| esomeprazole (CHEBI:50275) is enantiomer of (R)-omeprazole (CHEBI:77262) |
| Incoming Relation(s) |
| omeprazole (CHEBI:7772) has part esomeprazole (CHEBI:50275) |
| esomeprazole(1−) (CHEBI:77264) is conjugate base of esomeprazole (CHEBI:50275) |
| (R)-omeprazole (CHEBI:77262) is enantiomer of esomeprazole (CHEBI:50275) |
| IUPAC Name |
|---|
| 5-methoxy-2-{(S)-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole |
| INNs | Source |
|---|---|
| esomeprazol | ChEBI |
| esomeprazole | ChemIDplus |
| ésoméprazole | WHO MedNet |
| esomeprazolum | ChEBI |
| Synonyms | Source |
|---|---|
| (S)-(−)-omeprazole | ChemIDplus |
| (S)-omeprazole | ChemIDplus |
| (−)-omeprazole | ChemIDplus |
| Brand Names | Source |
|---|---|
| Alenia | ChemIDplus |
| Escz | ChemIDplus |
| Esofag | ChemIDplus |
| Inexium paranova | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1055 | DrugCentral |
| D07917 | KEGG DRUG |
| DB00736 | DrugBank |
| Esomeprazole | Wikipedia |
| HMDB0005009 | HMDB |
| HMDB0014874 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12060639 | Reaxys |
| CAS:119141-88-7 | ChemIDplus |
| Citations |
|---|