EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50190 - deptropine citrate
| Formula | C23H27NO.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 525.598 |
| Monoisotopic Mass | 525.23627 |
| SMILES | CN1[C@@H]2CC[C@H]1C[C@@H](OC1c3ccccc3CCc3ccccc31)C2.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H27NO.C6H8O7/c1-24-18-12-13-19(24)15-20(14-18)25-23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23;7-3(8)1-6(13,5(11)12)2-4(9)10/h2-9,18-20,23H,10-15H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t18-,19+,20+; |
| InChIKey | CHQGYMXXKZPWOI-BWSPSPBFSA-N |
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deptropine citrate (CHEBI:50190) has part deptropine (CHEBI:50189) |
| deptropine citrate (CHEBI:50190) has role H1-receptor antagonist (CHEBI:37955) |
| deptropine citrate (CHEBI:50190) has role muscarinic antagonist (CHEBI:48876) |
| deptropine citrate (CHEBI:50190) has role parasympatholytic (CHEBI:50370) |
| deptropine citrate (CHEBI:50190) is a citrate salt (CHEBI:50744) |
| IUPAC Name |
|---|
| (3-endo)-3-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yloxy)-8-methyl-8-azabicyclo[3.2.1]octane 2-hydroxypropane-1,2,3-tricarboxylate |
| Synonyms | Source |
|---|---|
| Deptrin | ChemIDplus |
| Dibenzheptropine citrate | ChemIDplus |
| Brontina | ChemIDplus |
| deptropine dihydrogen citrate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Deptropine FNA | KEGG DRUG |