EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50190 - deptropine citrate
| Formula | C23H27NO.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 525.598 |
| Monoisotopic Mass | 525.23627 |
| SMILES | CN1[C@@H]2CC[C@H]1C[C@@H](OC1c3ccccc3CCc3ccccc31)C2.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H27NO.C6H8O7/c1-24-18-12-13-19(24)15-20(14-18)25-23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23;7-3(8)1-6(13,5(11)12)2-4(9)10/h2-9,18-20,23H,10-15H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t18-,19+,20+; |
| InChIKey | CHQGYMXXKZPWOI-BWSPSPBFSA-N |
| Roles Classification |
|---|
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deptropine citrate (CHEBI:50190) has part deptropine (CHEBI:50189) |
| deptropine citrate (CHEBI:50190) has role H1-receptor antagonist (CHEBI:37955) |
| deptropine citrate (CHEBI:50190) has role muscarinic antagonist (CHEBI:48876) |
| deptropine citrate (CHEBI:50190) has role parasympatholytic (CHEBI:50370) |
| deptropine citrate (CHEBI:50190) is a citrate salt (CHEBI:50744) |
| IUPAC Name |
|---|
| (3-endo)-3-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yloxy)-8-methyl-8-azabicyclo[3.2.1]octane 2-hydroxypropane-1,2,3-tricarboxylate |
| Synonyms | Source |
|---|---|
| Brontina | ChemIDplus |
| Deptrin | ChemIDplus |
| deptropine dihydrogen citrate | ChemIDplus |
| Dibenzheptropine citrate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Deptropine FNA | KEGG DRUG |