EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C52H72GdN5O14 |
| Net Charge | 0 |
| Average Mass | 1148.419 |
| Monoisotopic Mass | 1148.43168 |
| SMILES | CCc1c(CC)c2[n]3c1C=C1C(CCCO)=C(C)C4=[N]1[Gd]315([O]C(C)=O)([O]C(C)=O)[N](=C4)c3cc(OCCOCCOCCOC)c(OCCOCCOCCOC)cc3[N]1=CC1=[N]5C(=C2)C(CCCO)=C1C |
| InChI | InChI=1S/C48H66N5O10.2C2H4O2.Gd/c1-7-35-36(8-2)40-28-42-38(12-10-14-55)34(4)46(53-42)32-50-44-30-48(63-26-24-61-22-20-59-18-16-57-6)47(62-25-23-60-21-19-58-17-15-56-5)29-43(44)49-31-45-33(3)37(11-9-13-54)41(52-45)27-39(35)51-40;2*1-2(3)4;/h27-32,54-55H,7-26H2,1-6H3;2*1H3,(H,3,4);/q-1;;;+3/p-2/b39-27-,40-28-,41-27-,42-28-,45-31-,46-32-,49-31+,49-43+,50-32+,50-44+;;; |
| InChIKey | VAZLWPAHMORDGR-WRIGXHCHSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| motexafin gadolinium (CHEBI:50161) has role antineoplastic agent (CHEBI:35610) |
| motexafin gadolinium (CHEBI:50161) is a gadolinium coordination entity (CHEBI:35730) |
| motexafin gadolinium (CHEBI:50161) is a metallotexaphyrin (CHEBI:50179) |
| motexafin gadolinium (CHEBI:50161) is a organic molecular entity (CHEBI:50860) |
| Incoming Relation(s) |
| motexafin gadolinium hydrate (CHEBI:50162) has part motexafin gadolinium (CHEBI:50161) |
| IUPAC Name |
|---|
| bis(acetato-κO){3,3'-[4,5-diethyl-16,17-bis{2-[2-(2-methoxyethoxy)ethoxy]ethoxy}-10,23-dimethyl-13,20,25,26,27-pentaazapentacyclo[20.2.1.13,6.18,11.014,19]heptacosa-1,3,5,7,9,11(26),12,14,16,18,20,22(25),23-tridecaene-9,24-diyl-κ5N13,N20,N25,N26,N27]dipropan-1-olato}gadolinium |
| Synonyms | Source |
|---|---|
| API-GP3 | ChEMBL |
| (PB-7-11-233'2'4)-bis(acetato-κO)(9,10-diethyl-20,21-bis(2-(2-(2-methoxyethoxy)ethoxy)ethoxy)-4,15-dimethyl-8,11-imino-3,6:16,13-dinitrilo-1,18-benzodiazacycloeicosine-5,14-dipropanolato-κN1,κN18,κN23,κN24,κN25)gadolinium | ChemIDplus |
| FP-GP1 | ChEMBL |
| gadolinium texaphyrin | ChemIDplus |
| Gd-Tex | ChemIDplus |
| Gd texaphyrin | ChemIDplus |
| Brand Name | Source |
|---|---|
| Xcytrin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| US2005159401 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10643305 | Beilstein |
| Gmelin:1458776 | Gmelin |
| Gmelin:1760576 | Gmelin |
| CAS:246252-06-2 | ChemIDplus |
| Citations |
|---|