EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19N3O3S |
| Net Charge | 0 |
| Average Mass | 357.435 |
| Monoisotopic Mass | 357.11471 |
| SMILES | CN(CCOc1ccc(C[C@H]2SC(=O)NC2=O)cc1)c1ccccn1 |
| InChI | InChI=1S/C18H19N3O3S/c1-21(16-4-2-3-9-19-16)10-11-24-14-7-5-13(6-8-14)12-15-17(22)20-18(23)25-15/h2-9,15H,10-12H2,1H3,(H,20,22,23)/t15-/m1/s1 |
| InChIKey | YASAKCUCGLMORW-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor An EC 6.2.1.* (acid-thiol ligase) inhibitor that interferes with the action of a long-chain-fatty-acid—CoA ligase (EC 6.2.1.3). insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). |
| Application: | insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-rosiglitazone (CHEBI:50123) is a rosiglitazone (CHEBI:50122) |
| (+)-rosiglitazone (CHEBI:50123) is enantiomer of (−)-rosiglitazone (CHEBI:50125) |
| Incoming Relation(s) |
| (−)-rosiglitazone (CHEBI:50125) is enantiomer of (+)-rosiglitazone (CHEBI:50123) |
| IUPAC Name |
|---|
| (5R)-5-(4-{2-[methyl(pyridin-2-yl)amino]ethoxy}benzyl)-1,3-thiazolidine-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| DB00412 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7082203 | Beilstein |