EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | C=C(C)C1CCC(C)=CC1=O |
| InChI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)6-10(9)11/h6,9H,1,4-5H2,2-3H3 |
| InChIKey | SEZLYIWMVRUIKT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isopiperitenone (CHEBI:50110) is a p-menthadien-3-one (CHEBI:26153) |
| Incoming Relation(s) |
| (+)-isopiperitenone (CHEBI:6041) is a isopiperitenone (CHEBI:50110) |
| (−)-isopiperitenone (CHEBI:15408) is a isopiperitenone (CHEBI:50110) |
| IUPAC Names |
|---|
| p-mentha-1,8-dien-3-one |
| 3-methyl-6-(prop-1-en-2-yl)cyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| 6-isopropenyl-3-methyl-2-cyclohexen-1-one | NIST Chemistry WebBook |
| 3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-one | NIST Chemistry WebBook |
| Isopiperitenon | ChemIDplus |
| UniProt Name | Source |
|---|---|
| isopiperitenone | UniProt |