EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | [H][C@]1(C(=C)C)CCC(C)=CC1=O |
| InChI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)6-10(9)11/h6,9H,1,4-5H2,2-3H3/t9-/m1/s1 |
| InChIKey | SEZLYIWMVRUIKT-SECBINFHSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-isopiperitenone (CHEBI:15408) is a isopiperitenone (CHEBI:50110) |
| (−)-isopiperitenone (CHEBI:15408) is enantiomer of (+)-isopiperitenone (CHEBI:6041) |
| Incoming Relation(s) |
| (+)-isopiperitenone (CHEBI:6041) is enantiomer of (−)-isopiperitenone (CHEBI:15408) |
| IUPAC Names |
|---|
| (4R)-p-mentha-1,8-dien-3-one |
| (6R)-3-methyl-6-(prop-1-en-2-yl)cyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| (-)-isopiperitenone | ChEBI |
| (-)-Isopiperitenone | KEGG COMPOUND |
| (-)-(4R)-Isopiperitenone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (6R)-isopiperitenone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02485 | KEGG COMPOUND |
| LMPR01020030 | LIPID MAPS |
| c0671 | UM-BBD |
| LMPR0102090009 | LIPID MAPS |
| C00000809 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5849572 | Beilstein |
| CAS:80995-97-7 | KEGG COMPOUND |