EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H5N3O2 |
| Net Charge | 0 |
| Average Mass | 103.081 |
| Monoisotopic Mass | 103.03818 |
| SMILES | CN(N=O)C(N)=O |
| InChI | InChI=1S/C2H5N3O2/c1-5(4-7)2(3)6/h1H3,(H2,3,6) |
| InChIKey | ZRKWMRDKSOPRRS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-N-nitrosourea (CHEBI:50102) has role alkylating agent (CHEBI:22333) |
| N-methyl-N-nitrosourea (CHEBI:50102) has role carcinogenic agent (CHEBI:50903) |
| N-methyl-N-nitrosourea (CHEBI:50102) has role mutagen (CHEBI:25435) |
| N-methyl-N-nitrosourea (CHEBI:50102) has role teratogenic agent (CHEBI:50905) |
| N-methyl-N-nitrosourea (CHEBI:50102) is a N-nitrosoureas (CHEBI:76551) |
| IUPAC Name |
|---|
| 1-methyl-1-nitrosourea |
| Synonyms | Source |
|---|---|
| 1-(aminocarbonyl)-1-methyl-2-oxohydrazine | NIST Chemistry WebBook |
| 1-nitroso-1-methylurea | ChemIDplus |
| N-methyl-N-nitrosocarbamide | ChemIDplus |
| N-Methyl-N-nitrosoharnstoff | ChEBI |
| N-méthyl-N-nitrosourée | ChEBI |
| N-nitroso-N-methylcarbamide | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C14595 | KEGG COMPOUND |
| N-Methyl-N-nitrosourea | Wikipedia |
| Citations |
|---|