EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O3 |
| Net Charge | 0 |
| Average Mass | 242.274 |
| Monoisotopic Mass | 242.09429 |
| SMILES | CC(C(=O)O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C15H14O3/c1-11(15(16)17)12-6-5-9-14(10-12)18-13-7-3-2-4-8-13/h2-11H,1H3,(H,16,17) |
| InChIKey | RDJGLLICXDHJDY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenoprofen (CHEBI:5004) has role antipyretic (CHEBI:35493) |
| fenoprofen (CHEBI:5004) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| fenoprofen (CHEBI:5004) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| fenoprofen (CHEBI:5004) has role drug allergen (CHEBI:88188) |
| fenoprofen (CHEBI:5004) has role non-narcotic analgesic (CHEBI:35481) |
| fenoprofen (CHEBI:5004) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| fenoprofen (CHEBI:5004) is a monocarboxylic acid (CHEBI:25384) |
| fenoprofen (CHEBI:5004) is conjugate acid of fenoprofen(1−) (CHEBI:60566) |
| Incoming Relation(s) |
| fenoprofen(1−) (CHEBI:60566) is conjugate base of fenoprofen (CHEBI:5004) |
| IUPAC Name |
|---|
| 2-(3-phenoxyphenyl)propanoic acid |
| INNs | Source |
|---|---|
| fenoprofen | ChemIDplus |
| fenoprofene | ChemIDplus |
| fenoprofeno | ChemIDplus |
| fenoprofenum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (±)-2-(3-phenoxyphenyl)propionic acid | ChemIDplus |
| 2-(3-phenoxyphenyl)propionic acid | ChEBI |
| 2-(m-phenoxyphenyl)propionic acid | ChEBI |
| (±)-m-phenoxyhydratropic acid | ChemIDplus |
| Fenoprofen | KEGG COMPOUND |
| FENOPROFEN | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2118687 | Reaxys |
| CAS:31879-05-7 | ChemIDplus |
| CAS:31879-05-7 | NIST Chemistry WebBook |
| CAS:31879-05-7 | KEGG COMPOUND |
| Citations |
|---|