EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O3 |
| Net Charge | 0 |
| Average Mass | 242.274 |
| Monoisotopic Mass | 242.09429 |
| SMILES | CC(C(=O)O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C15H14O3/c1-11(15(16)17)12-6-5-9-14(10-12)18-13-7-3-2-4-8-13/h2-11H,1H3,(H,16,17) |
| InChIKey | RDJGLLICXDHJDY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. drug allergen Any drug which causes the onset of an allergic reaction. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. drug allergen Any drug which causes the onset of an allergic reaction. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenoprofen (CHEBI:5004) has role antipyretic (CHEBI:35493) |
| fenoprofen (CHEBI:5004) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| fenoprofen (CHEBI:5004) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| fenoprofen (CHEBI:5004) has role drug allergen (CHEBI:88188) |
| fenoprofen (CHEBI:5004) has role non-narcotic analgesic (CHEBI:35481) |
| fenoprofen (CHEBI:5004) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| fenoprofen (CHEBI:5004) is a monocarboxylic acid (CHEBI:25384) |
| fenoprofen (CHEBI:5004) is conjugate acid of fenoprofen(1−) (CHEBI:60566) |
| Incoming Relation(s) |
| fenoprofen(1−) (CHEBI:60566) is conjugate base of fenoprofen (CHEBI:5004) |
| IUPAC Name |
|---|
| 2-(3-phenoxyphenyl)propanoic acid |
| INNs | Source |
|---|---|
| fenoprofen | ChemIDplus |
| fenoprofene | ChemIDplus |
| fenoprofeno | ChemIDplus |
| fenoprofenum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (±)-2-(3-phenoxyphenyl)propionic acid | ChemIDplus |
| 2-(3-phenoxyphenyl)propionic acid | ChEBI |
| 2-(m-phenoxyphenyl)propionic acid | ChEBI |
| (±)-m-phenoxyhydratropic acid | ChemIDplus |
| Fenoprofen | KEGG COMPOUND |
| FENOPROFEN | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2118687 | Reaxys |
| CAS:31879-05-7 | ChemIDplus |
| CAS:31879-05-7 | NIST Chemistry WebBook |
| CAS:31879-05-7 | KEGG COMPOUND |
| Citations |
|---|