EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | CC1=CCC(C(C)C)C=C1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4-6,8,10H,7H2,1-3H3 |
| InChIKey | OGLDWXZKYODSOB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-phellandrene (CHEBI:50035) has role antimicrobial agent (CHEBI:33281) |
| α-phellandrene (CHEBI:50035) has role plant metabolite (CHEBI:76924) |
| α-phellandrene (CHEBI:50035) has role volatile oil component (CHEBI:27311) |
| α-phellandrene (CHEBI:50035) is a cyclohexadiene (CHEBI:37613) |
| α-phellandrene (CHEBI:50035) is a phellandrene (CHEBI:50034) |
| Incoming Relation(s) |
| (+)-α-phellandrene (CHEBI:367) is a α-phellandrene (CHEBI:50035) |
| (−)-α-phellandrene (CHEBI:301) is a α-phellandrene (CHEBI:50035) |
| IUPAC Names |
|---|
| 2-methyl-5-(propan-2-yl)cyclohexa-1,3-diene |
| p-mentha-1,5-diene |
| Synonyms | Source |
|---|---|
| 1-isopropyl-4-methyl-2,4-cyclohexadiene | ChemIDplus |
| 1-methyl-4-isopropyl-1,5-cyclohexadiene | ChemIDplus |
| 2-methyl-5-(1-methylethyl)-1,3-cyclohexadiene | NIST Chemistry WebBook |
| 2-methyl-5-isopropyl-1,3-cyclohexadiene | ChemIDplus |
| 4-isopropyl-1-methyl-1,5-cyclohexadiene | ChemIDplus |
| 5-isopropyl-2-methyl-1,3-cyclohexadiene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-12226 | MetaCyc |
| HMDB0035850 | HMDB |
| Citations |
|---|