EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | [H][C@]1(C(C)C)C=CC(C)=CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4-6,8,10H,7H2,1-3H3/t10-/m0/s1 |
| InChIKey | OGLDWXZKYODSOB-JTQLQIEISA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| IUPAC Names |
|---|
| (4S)-p-mentha-1,5-diene |
| (5S)-2-methyl-5-(propan-2-yl)cyclohexa-1,3-diene |
| Synonyms | Source |
|---|---|
| (4S)-p-mentha-1(6),2-diene | IUPAC |
| (5S)-5-isopropyl-2-methylcyclohexa-1,3-diene | IUPAC |
| (S)-(+)-alpha-Phellandrene | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11391 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3194394 | Beilstein |
| Reaxys:5239644 | Reaxys |
| CAS:2243-33-6 | KEGG COMPOUND |