EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7AsO2 |
| Net Charge | 0 |
| Average Mass | 186.042 |
| Monoisotopic Mass | 185.96620 |
| SMILES | O[As](O)c1ccccc1 |
| InChI | InChI=1S/C6H7AsO2/c8-7(9)6-4-2-1-3-5-6/h1-5,8-9H |
| InChIKey | CWAJOULDYUXQAN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylarsonous acid (CHEBI:50019) is a arsonous acids (CHEBI:50017) |
| Incoming Relation(s) |
| aminophenylarsonous acid (CHEBI:50020) has functional parent phenylarsonous acid (CHEBI:50019) |
| nitarsone (III) (CHEBI:232329) has functional parent phenylarsonous acid (CHEBI:50019) |
| IUPAC Name |
|---|
| phenylarsonous acid |
| Synonym | Source |
|---|---|
| benzenearsonous acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2828403 | Beilstein |
| Gmelin:406345 | Gmelin |
| CAS:25400-22-0 | ChemIDplus |