EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6AsNO4 |
| Net Charge | 0 |
| Average Mass | 231.039 |
| Monoisotopic Mass | 230.95128 |
| SMILES | O=[N+]([O-])c1ccc([As](O)O)cc1 |
| InChI | InChI=1S/C6H6AsNO4/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4,9-10H |
| InChIKey | DYZPMOXUNFTAHR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitarsone (III) (CHEBI:232329) has functional parent phenylarsonous acid (CHEBI:50019) |
| nitarsone (III) (CHEBI:232329) is a C-nitro compound (CHEBI:35716) |
| nitarsone (III) (CHEBI:232329) is a arsonous acids (CHEBI:50017) |
| UniProt Name | Source |
|---|---|
| nitarsone (III) | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-24364 | MetaCyc |
| Citations |
|---|