EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16F3N |
| Net Charge | 0 |
| Average Mass | 231.261 |
| Monoisotopic Mass | 231.12348 |
| SMILES | CCNC(C)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3N/c1-3-16-9(2)7-10-5-4-6-11(8-10)12(13,14)15/h4-6,8-9,16H,3,7H2,1-2H3 |
| InChIKey | DBGIVFWFUFKIQN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. appetite depressant Any agent that is used to decrease appetite. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenfluramine (CHEBI:5000) has role appetite depressant (CHEBI:50507) |
| fenfluramine (CHEBI:5000) has role serotonergic agonist (CHEBI:35941) |
| fenfluramine (CHEBI:5000) has role serotonin uptake inhibitor (CHEBI:50949) |
| fenfluramine (CHEBI:5000) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| fenfluramine (CHEBI:5000) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| fenfluramine hydrochloride (CHEBI:59729) has part fenfluramine (CHEBI:5000) |
| (R)-fenfluramine (CHEBI:521051) is a fenfluramine (CHEBI:5000) |
| (S)-fenfluramine (CHEBI:439329) is a fenfluramine (CHEBI:5000) |
| IUPAC Name |
|---|
| N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine |
| INNs | Source |
|---|---|
| fenfluraminum | ChemIDplus |
| fenfluramine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Fenfluramine | KEGG COMPOUND |
| N-ethyl-1-(3-(trifluoromethyl)phenyl)propan-2-amine | ChEMBL |
| Ethyl-[1-methyl-2-(3-trifluoromethyl-phenyl)-ethyl]-amine | ChEMBL |
| 1-(m-trifluoromethyl-phenyl)-2-ethylaminopropane | ChemIDplus |
| 2-ethylamino-1-(3-trifluoromethylphenyl)propane | ChemIDplus |
| N-ethyl-α-methyl-3-trifluoromethylphenethylamine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C06996 | KEGG COMPOUND |
| D07945 | KEGG DRUG |
| DB00574 | DrugBank |
| US3198833 | Patent |
| HMDB0015322 | HMDB |
| Fenfluramine | Wikipedia |
| 1150 | DrugCentral |
| Citations |
|---|