EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24BrFN4O2 |
| Net Charge | 0 |
| Average Mass | 475.362 |
| Monoisotopic Mass | 474.10667 |
| SMILES | COc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCC1CCN(C)CC1 |
| InChI | InChI=1S/C22H24BrFN4O2/c1-28-7-5-14(6-8-28)12-30-21-11-19-16(10-20(21)29-2)22(26-13-25-19)27-18-4-3-15(23)9-17(18)24/h3-4,9-11,13-14H,5-8,12H2,1-2H3,(H,25,26,27) |
| InChIKey | UHTHHESEBZOYNR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vandetanib (CHEBI:49960) has role antineoplastic agent (CHEBI:35610) |
| vandetanib (CHEBI:49960) has role tyrosine kinase inhibitor (CHEBI:38637) |
| vandetanib (CHEBI:49960) is a aromatic ether (CHEBI:35618) |
| vandetanib (CHEBI:49960) is a organobromine compound (CHEBI:37141) |
| vandetanib (CHEBI:49960) is a organofluorine compound (CHEBI:37143) |
| vandetanib (CHEBI:49960) is a piperidines (CHEBI:26151) |
| vandetanib (CHEBI:49960) is a quinazolines (CHEBI:38530) |
| vandetanib (CHEBI:49960) is a secondary amine (CHEBI:32863) |
| Incoming Relation(s) |
| linkable vandetanib analogue (CHEBI:39080) has functional parent vandetanib (CHEBI:49960) |
| IUPAC Name |
|---|
| N-(4-bromo-2-fluorophenyl)-6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-amine |
| INN | Source |
|---|---|
| vandetanib | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 4-BROMO-2-FLUORO-N-[(4E)-6-METHOXY-7-[(1-METHYLPIPERIDIN-4-YL)METHOXY]QUINAZOLIN-4(1H)-YLIDENE]ANILINE | PDBeChem |
| ZD 6474 | ChemIDplus |
| ZD6474 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Zactima | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4178 | DrugCentral |
| D06407 | KEGG DRUG |
| DB08764 | DrugBank |
| LSM-1199 | LINCS |
| US2006135486 | Patent |
| US2008032989 | Patent |
| US2008199480 | Patent |
| Vandetanib | Wikipedia |
| WO2005115145 | Patent |
| WO2006005915 | Patent |
| WO2007036713 | Patent |
| WO2008001101 | Patent |
| WO2008007113 | Patent |
| WO2009024825 | Patent |
| WO2012055015 | Patent |
| ZD6 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9161676 | Reaxys |
| CAS:443913-73-3 | ChemIDplus |
| Citations |
|---|