EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:49791 - PD173955
| Formula | C21H16Cl2N4OS |
| Net Charge | 0 |
| Average Mass | 443.359 |
| Monoisotopic Mass | 442.04219 |
| SMILES | CSc1cccc(Nc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(C)c3n2)c1 |
| InChI | InChI=1S/C21H16Cl2N4OS/c1-27-19-12(9-15(20(27)28)18-16(22)7-4-8-17(18)23)11-24-21(26-19)25-13-5-3-6-14(10-13)29-2/h3-11H,1-2H3,(H,24,25,26) |
| InChIKey | VAARYSWULJUGST-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PD173955 (CHEBI:49791) has role tyrosine kinase inhibitor (CHEBI:38637) |
| PD173955 (CHEBI:49791) is a aryl sulfide (CHEBI:35683) |
| PD173955 (CHEBI:49791) is a dichlorobenzene (CHEBI:23697) |
| PD173955 (CHEBI:49791) is a methyl sulfide (CHEBI:86315) |
| PD173955 (CHEBI:49791) is a pyridopyrimidine (CHEBI:38932) |
| Incoming Relation(s) |
| linkable PD173955 analogue (CHEBI:39079) has functional parent PD173955 (CHEBI:49791) |
| IUPAC Name |
|---|
| 6-(2,6-dichlorophenyl)-8-methyl-2-{[3-(methylsulfanyl)phenyl]amino}pyrido[2,3-d]pyrimidin-7(8H)-one |
| Synonyms | Source |
|---|---|
| 6-(2,6-DICHLORO-PHENYL)-8-METHYL-2-(3-METHYLSULFANYL-PHENYLAMINO)-8H-PYRIDO[2,3-D]PYRIMIDIN-7-ONE | PDBeChem |
| 6-(2,6-dichlorophenyl)-8-methyl-2-{[3-(methylthio)phenyl]amino}pyrido[2,3-d]pyrimidin-7(8H)-one | ChEBI |