EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H26ClFN4O4S |
| Net Charge | 0 |
| Average Mass | 581.069 |
| Monoisotopic Mass | 580.13473 |
| SMILES | CS(=O)(=O)CCNCc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C29H26ClFN4O4S/c1-40(36,37)12-11-32-16-23-7-10-27(39-23)20-5-8-26-24(14-20)29(34-18-33-26)35-22-6-9-28(25(30)15-22)38-17-19-3-2-4-21(31)13-19/h2-10,13-15,18,32H,11-12,16-17H2,1H3,(H,33,34,35) |
| InChIKey | BCFGMOOMADDAQU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lapatinib (CHEBI:49603) has functional parent monofluorobenzene (CHEBI:5115) |
| lapatinib (CHEBI:49603) has role antineoplastic agent (CHEBI:35610) |
| lapatinib (CHEBI:49603) has role tyrosine kinase inhibitor (CHEBI:38637) |
| lapatinib (CHEBI:49603) is a furans (CHEBI:24129) |
| lapatinib (CHEBI:49603) is a organochlorine compound (CHEBI:36683) |
| lapatinib (CHEBI:49603) is a organofluorine compound (CHEBI:37143) |
| lapatinib (CHEBI:49603) is a quinazolines (CHEBI:38530) |
| IUPAC Name |
|---|
| N-[3-chloro-4-(3-fluorobenzyloxy)phenyl]-6-[5-({[2-(methanesulfonyl)ethyl]amino}methyl)furan-2-yl]quinazolin-4-amine |
| Synonyms | Source |
|---|---|
| GW 572016 | ChemIDplus |
| N-{3-CHLORO-4-[(3-FLUOROBENZYL)OXY]PHENYL}-6-[5-({[2-(METHYLSULFONYL)ETHYL]AMINO}METHYL)-2-FURYL]-4-QUINAZOLINAMINE | PDBeChem |
| N-(3-chloro-4-((3-fluorophenyl)methoxy)phenyl)-6-(5-(((2-(methylsulfonyl)ethyl)amino)methyl)-2-furanyl)-4-quinazolinamine | ChemIDplus |
| Tykerb | ChemIDplus |