EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18ClN3O5S |
| Net Charge | 0 |
| Average Mass | 435.889 |
| Monoisotopic Mass | 435.06557 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)c1c(-c2ccccc2Cl)noc1C |
| InChI | InChI=1S/C19H18ClN3O5S/c1-8-11(12(22-28-8)9-6-4-5-7-10(9)20)15(24)21-13-16(25)23-14(18(26)27)19(2,3)29-17(13)23/h4-7,13-14,17H,1-3H3,(H,21,24)(H,26,27)/t13-,14+,17-/m1/s1 |
| InChIKey | LQOLIRLGBULYKD-JKIFEVAISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cloxacillin (CHEBI:49566) has functional parent oxacillin (CHEBI:7809) |
| cloxacillin (CHEBI:49566) has role antibacterial agent (CHEBI:33282) |
| cloxacillin (CHEBI:49566) has role antibacterial drug (CHEBI:36047) |
| cloxacillin (CHEBI:49566) is a penicillin (CHEBI:17334) |
| cloxacillin (CHEBI:49566) is a penicillin allergen (CHEBI:88187) |
| cloxacillin (CHEBI:49566) is a semisynthetic derivative (CHEBI:72588) |
| cloxacillin (CHEBI:49566) is conjugate acid of cloxacillin(1−) (CHEBI:51350) |
| Incoming Relation(s) |
| cloxacillin(1−) (CHEBI:51350) is conjugate base of cloxacillin (CHEBI:49566) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-({[5-methyl-3-(2-chlorophenyl)isoxazol-4-yl]carbonyl}amino)penam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| cloxacilina | ChemIDplus |
| cloxacillin | KEGG DRUG |
| cloxacilline | ChemIDplus |
| cloxacillinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-({[3-(2-chlorophenyl)-5-methylisoxazol-4-yl]carbonyl}amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| (3-(o-chlorophenyl)-5-methyl-4-isoxazolyl)penicillin | ChemIDplus |
| 6-(3-(o-chlorophenyl)-5-methyl-4-isoxazolecarboxamido)penicillanic acid | ChemIDplus |
| Cloxacillin | KEGG COMPOUND |
| CLOXACILLIN | PDBeChem |
| Citations |
|---|