EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17ClN3O5S |
| Net Charge | -1 |
| Average Mass | 434.881 |
| Monoisotopic Mass | 434.05829 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)c1c(-c2ccccc2Cl)noc1C |
| InChI | InChI=1S/C19H18ClN3O5S/c1-8-11(12(22-28-8)9-6-4-5-7-10(9)20)15(24)21-13-16(25)23-14(18(26)27)19(2,3)29-17(13)23/h4-7,13-14,17H,1-3H3,(H,21,24)(H,26,27)/p-1/t13-,14+,17-/m1/s1 |
| InChIKey | LQOLIRLGBULYKD-JKIFEVAISA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cloxacillin(1−) (CHEBI:51350) is a penicillinate anion (CHEBI:51356) |
| cloxacillin(1−) (CHEBI:51350) is conjugate base of cloxacillin (CHEBI:49566) |
| Incoming Relation(s) |
| cloxacillin benzathine (CHEBI:51351) has part cloxacillin(1−) (CHEBI:51350) |
| cloxacillin sodium (CHEBI:51357) has part cloxacillin(1−) (CHEBI:51350) |
| cloxacillin (CHEBI:49566) is conjugate acid of cloxacillin(1−) (CHEBI:51350) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-({[5-methyl-3-(2-chlorophenyl)isoxazol-4-yl]carbonyl}amino)penam-3α-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5406065 | Beilstein |