EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:49274 - (−)-β-selinene
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@]1(C(=C)C)CC[C@]2(C)CCCC(=C)[C@@]2([H])C1 |
| InChI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h13-14H,1,3,5-10H2,2,4H3/t13-,14+,15-/m0/s1 |
| InChIKey | YOVSPTNQHMDJAG-ZNMIVQPWSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-β-selinene (CHEBI:49274) is a β-selinene (CHEBI:49276) |
| (−)-β-selinene (CHEBI:49274) is enantiomer of (+)-β-selinene (CHEBI:10443) |
| Incoming Relation(s) |
| (+)-β-selinene (CHEBI:10443) is enantiomer of (−)-β-selinene (CHEBI:49274) |
| IUPAC Names |
|---|
| (4aS,7S,8aR)-4a-methyl-1-methylidene-7-(prop-1-en-2-yl)decahydronaphthalene |
| (5β,7α,10α)-eudesma-4(14),11-diene |
| Synonym | Source |
|---|---|
| (4aS,7S,8aR)-7-isopropenyl-4a-methyl-1-methylenedecahydronaphthalene | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3082013 | Beilstein |
| Reaxys:4970262 | Reaxys |