EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]1(C(=C)C)CC[C@@]2(C)CCCC(=C)[C@]2([H])C1 |
| InChI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h13-14H,1,3,5-10H2,2,4H3/t13-,14+,15-/m1/s1 |
| InChIKey | YOVSPTNQHMDJAG-QLFBSQMISA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-β-selinene (CHEBI:10443) is a β-selinene (CHEBI:49276) |
| (+)-β-selinene (CHEBI:10443) is enantiomer of (−)-β-selinene (CHEBI:49274) |
| Incoming Relation(s) |
| (−)-β-selinene (CHEBI:49274) is enantiomer of (+)-β-selinene (CHEBI:10443) |
| IUPAC Names |
|---|
| (4aR,7R,8aS)-4a-methyl-1-methylidene-7-(prop-1-en-2-yl)decahydronaphthalene |
| eudesma-4(14),11-diene |
| Synonyms | Source |
|---|---|
| [4aR-(4aα,7α,8aβ)]-decahydro-4a-methyl-1-methylene-7-(1-methylethenyl)-naphthalene | NIST Chemistry WebBook |
| (4aR,7R,8aS)-7-isopropenyl-4a-methyl-1-methylenedecahydronaphthalene | IUPAC |
| beta-Selinene | KEGG COMPOUND |
| β-eudesmene | NIST Chemistry WebBook |
| (+)-β-selinene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (+)-β-selinene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2044561 | Beilstein |
| Reaxys:4664142 | Reaxys |
| CAS:17066-67-0 | NIST Chemistry WebBook |
| CAS:17066-67-0 | KEGG COMPOUND |
| CAS:17066-67-0 | ChemIDplus |