EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O2 |
| Net Charge | 0 |
| Average Mass | 124.139 |
| Monoisotopic Mass | 124.05243 |
| SMILES | O=C(O)C1=CCCC=C1 |
| InChI | InChI=1S/C7H8O2/c8-7(9)6-4-2-1-3-5-6/h2,4-5H,1,3H2,(H,8,9) |
| InChIKey | QXHJRNVPNQKMLR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclohexa-1,5-diene-1-carboxylic acid (CHEBI:49262) is a cyclohexadienecarboxylic acid (CHEBI:23468) |
| cyclohexa-1,5-diene-1-carboxylic acid (CHEBI:49262) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| cyclohexa-1,5-diene-1-carbonyl-CoA (CHEBI:15520) has functional parent cyclohexa-1,5-diene-1-carboxylic acid (CHEBI:49262) |
| IUPAC Name |
|---|
| cyclohexa-1,5-diene-1-carboxylic acid |
| Synonym | Source |
|---|---|
| 3,4-dihydrobenzoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2431062 | Beilstein |
| CAS:40002-23-1 | ChemIDplus |