EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@]1(/C(C)=C\CC=C(C)C)CC=C(C)CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6-8,15H,5,9-11H2,1-4H3/b14-7-/t15-/m0/s1 |
| InChIKey | YHBUQBJHSRGZNF-GSHXUFRSSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R,Z)-α-bisabolene (CHEBI:49245) is a (Z)-α-bisabolene (CHEBI:49241) |
| (R,Z)-α-bisabolene (CHEBI:49245) is enantiomer of (S,Z)-α-bisabolene (CHEBI:49246) |
| Incoming Relation(s) |
| (S,Z)-α-bisabolene (CHEBI:49246) is enantiomer of (R,Z)-α-bisabolene (CHEBI:49245) |
| IUPAC Names |
|---|
| (1R,9Z)-bisabola-4,7(11),9-triene |
| (4R)-4-[(1Z)-1,5-dimethylhexa-1,4-dien-1-yl]-1-methylcyclohexene |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2414201 | Beilstein |