EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC(C)=CC/C=C(/C)C1CC=C(C)CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6-8,15H,5,9-11H2,1-4H3/b14-7- |
| InChIKey | YHBUQBJHSRGZNF-AUWJEWJLSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-α-bisabolene (CHEBI:49241) has role plant metabolite (CHEBI:76924) |
| (Z)-α-bisabolene (CHEBI:49241) is a α-bisabolene (CHEBI:49240) |
| Incoming Relation(s) |
| (R,Z)-α-bisabolene (CHEBI:49245) is a (Z)-α-bisabolene (CHEBI:49241) |
| (S,Z)-α-bisabolene (CHEBI:49246) is a (Z)-α-bisabolene (CHEBI:49241) |
| IUPAC Names |
|---|
| (9Z)-bisabola-4,7(11),9-triene |
| 4-[(1Z)-1,5-dimethylhexa-1,4-dien-1-yl]-1-methylcyclohexene |
| Synonym | Source |
|---|---|
| cis-α-bisabolene | ChEBI |
| UniProt Name | Source |
|---|---|
| (Z)-α-bisabolene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMPR0103060006 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2208810 | Reaxys |
| Citations |
|---|