EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC(C)=CCC/C(C)=C1\CC=C(C)CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8H,5,7,9-11H2,1-4H3/b15-14+ |
| InChIKey | XBGUIVFBMBVUEG-CCEZHUSRSA-N |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-γ-bisabolene (CHEBI:49238) is a γ-bisabolene (CHEBI:49237) |
| IUPAC Names |
|---|
| (1Z)-bisabola-1(10),4,7(11)-triene |
| (4Z)-4-(1,5-dimethylhex-4-en-1-ylidene)-1-methylcyclohexene |
| UniProt Name | Source |
|---|---|
| (Z)-γ-bisabolene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C16814 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2043733 | Beilstein |
| CAS:495-62-5 | KEGG COMPOUND |