EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC(C)=CCCC(C)=C1CC=C(C)CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8H,5,7,9-11H2,1-4H3 |
| InChIKey | XBGUIVFBMBVUEG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-bisabolene (CHEBI:49237) has role flavouring agent (CHEBI:35617) |
| γ-bisabolene (CHEBI:49237) is a bisabolene (CHEBI:49235) |
| Incoming Relation(s) |
| (E)-γ-bisabolene (CHEBI:49239) is a γ-bisabolene (CHEBI:49237) |
| (Z)-γ-bisabolene (CHEBI:49238) is a γ-bisabolene (CHEBI:49237) |
| IUPAC Names |
|---|
| 4-(1,5-dimethylhex-4-en-1-ylidene)-1-methylcyclohexene |
| bisabola-1(10),4,7(11)-triene |
| Synonyms | Source |
|---|---|
| 1-methyl-4-(1,5-dimethyl-4-hexenylidene)-1-cyclohexene | ChemIDplus |
| 2-methyl-6-(4-methyl-3-cyclohexen-1-ylidene)-2-heptene | ChemIDplus |
| 4-(1,5-dimethyl-4-hexen-1-ylidene)-1-methylcyclohexene | ChEBI |
| 4-(1,5-dimethyl-4-hexenylidene)-1-methylcyclohexene | ChemIDplus |
| bisabolene | ChemIDplus |
| FEMA 3331 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2501191 | Beilstein |
| CAS:495-62-5 | ChemIDplus |