EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO3 |
| Net Charge | 0 |
| Average Mass | 287.359 |
| Monoisotopic Mass | 287.15214 |
| SMILES | CCc1cccc2c3c(nc12)C(CC)(CC(=O)O)OCC3 |
| InChI | InChI=1S/C17H21NO3/c1-3-11-6-5-7-12-13-8-9-21-17(4-2,10-14(19)20)16(13)18-15(11)12/h5-7,18H,3-4,8-10H2,1-2H3,(H,19,20) |
| InChIKey | NNYBQONXHNTVIJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etodolac (CHEBI:4909) has role antipyretic (CHEBI:35493) |
| etodolac (CHEBI:4909) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| etodolac (CHEBI:4909) has role non-narcotic analgesic (CHEBI:35481) |
| etodolac (CHEBI:4909) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| etodolac (CHEBI:4909) is a monocarboxylic acid (CHEBI:25384) |
| etodolac (CHEBI:4909) is a organic heterotricyclic compound (CHEBI:26979) |
| Incoming Relation(s) |
| (R)-etodolac (CHEBI:60370) is a etodolac (CHEBI:4909) |
| (S)-etodolac (CHEBI:60371) is a etodolac (CHEBI:4909) |
| IUPAC Name |
|---|
| (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetic acid |
| INNs | Source |
|---|---|
| etodolac | ChemIDplus |
| etodolaco | ChemIDplus |
| etodolacum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,3,4,9-tetrahydro-1,8-diethylpyrano(3,4-b)indole-1-acetic acid | ChemIDplus |
| (1,8-Diethyl-1,3,4,9-tetrahydro-pyrano[3,4-b]indol-1-yl)-acetic acid | ChEMBL |
| 1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-ylacetic acid | ChEBI |
| (±)-1,8-diethyl-1,3,4,9-tetrahydropyrano(3,4-b)indole-1-acetic acid | ChemIDplus |
| 1,8-diethyl-1,3,4,9-tetrahydropyrano(3,4-b)indole-1-acetic acid | ChemIDplus |
| ETODOLAC | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:41340-25-4 | ChemIDplus |
| CAS:41340-25-4 | KEGG DRUG |
| Citations |
|---|