EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO3S |
| Net Charge | 0 |
| Average Mass | 165.214 |
| Monoisotopic Mass | 165.04596 |
| SMILES | CS(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C5H11NO3S/c1-10(9)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | QEFRNWWLZKMPFJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (12576054) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methionine S-oxide (CHEBI:49033) has role biomarker (CHEBI:59163) |
| methionine S-oxide (CHEBI:49033) has role human metabolite (CHEBI:77746) |
| methionine S-oxide (CHEBI:49033) is a methionine derivative (CHEBI:25230) |
| Incoming Relation(s) |
| D-methionine S-oxide (CHEBI:49034) is a methionine S-oxide (CHEBI:49033) |
| L-methionine S-oxide (CHEBI:17016) is a methionine S-oxide (CHEBI:49033) |
| IUPAC Name |
|---|
| 2-amino-4-(methylsulfinyl)butanoic acid |
| Synonym | Source |
|---|---|
| methionine sulfoxide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB02235 | DrugBank |
| CPD0-1959 | MetaCyc |
| HMDB0002005 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2206690 | Reaxys |
| CAS:62697-73-8 | ChemIDplus |
| Citations |
|---|