EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO3S |
| Net Charge | 0 |
| Average Mass | 165.214 |
| Monoisotopic Mass | 165.04596 |
| SMILES | CS(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO3S/c1-10(9)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-,10?/m0/s1 |
| InChIKey | QEFRNWWLZKMPFJ-YGVKFDHGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-methionine S-oxide (CHEBI:17016) has role Escherichia coli metabolite (CHEBI:76971) |
| L-methionine S-oxide (CHEBI:17016) is a methionine S-oxide (CHEBI:49033) |
| Incoming Relation(s) |
| L-methionine (R)-S-oxide (CHEBI:49032) is a L-methionine S-oxide (CHEBI:17016) |
| L-methionine (S)-S-oxide (CHEBI:49031) is a L-methionine S-oxide (CHEBI:17016) |
| L-methionine S-oxide residue (CHEBI:15989) is substituent group from L-methionine S-oxide (CHEBI:17016) |
| IUPAC Names |
|---|
| (2S)-2-amino-4-(methylsulfinyl)butanoic acid |
| L-methionine S-oxide |
| Synonyms | Source |
|---|---|
| L-Methionine S-oxide | KEGG COMPOUND |
| methionine S-oxide | ChemIDplus |
| L-methionine sulfoxide | ChemIDplus |