EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N2O3 |
| Net Charge | 0 |
| Average Mass | 132.119 |
| Monoisotopic Mass | 132.05349 |
| SMILES | NC(=O)[C@H](N)CC(=O)O |
| InChI | InChI=1S/C4H8N2O3/c5-2(4(6)9)1-3(7)8/h2H,1,5H2,(H2,6,9)(H,7,8)/t2-/m1/s1 |
| InChIKey | PMLJIHNCYNOQEQ-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-aspartic 1-amide (CHEBI:49011) is a D-aspartic acid derivative (CHEBI:83979) |
| D-aspartic 1-amide (CHEBI:49011) is a aspartic 1-amide (CHEBI:49010) |
| D-aspartic 1-amide (CHEBI:49011) is enantiomer of L-aspartic 1-amide (CHEBI:21248) |
| Incoming Relation(s) |
| L-aspartic 1-amide (CHEBI:21248) is enantiomer of D-aspartic 1-amide (CHEBI:49011) |
| IUPAC Names |
|---|
| D-aspartic 1-amide |
| (3R)-3,4-diamino-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| D-α-asparagine | ChEBI |
| D-aspartic acid 1-amide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1723520 | Beilstein |