EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N2O3 |
| Net Charge | 0 |
| Average Mass | 132.119 |
| Monoisotopic Mass | 132.05349 |
| SMILES | NC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C4H8N2O3/c5-2(4(6)9)1-3(7)8/h2H,1,5H2,(H2,6,9)(H,7,8) |
| InChIKey | PMLJIHNCYNOQEQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspartic 1-amide (CHEBI:49010) is a amino acid amide (CHEBI:22475) |
| aspartic 1-amide (CHEBI:49010) is a aspartic acid derivative (CHEBI:22661) |
| aspartic 1-amide (CHEBI:49010) is a β-amino acid (CHEBI:33706) |
| Incoming Relation(s) |
| D-aspartic 1-amide (CHEBI:49011) is a aspartic 1-amide (CHEBI:49010) |
| L-aspartic 1-amide (CHEBI:21248) is a aspartic 1-amide (CHEBI:49010) |
| IUPAC Names |
|---|
| aspartic 1-amide |
| 3,4-diamino-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| isoasparagine | ChemIDplus |
| DL-isoasparagine | ChemIDplus |
| DL-α-asparagine | ChemIDplus |
| 3-aminosuccinamic acid | ChemIDplus |
| α-asparagine | ChEBI |
| aspartic acid 1-amide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1723519 | Beilstein |
| CAS:498-25-9 | ChemIDplus |