EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O |
| Net Charge | 0 |
| Average Mass | 208.260 |
| Monoisotopic Mass | 208.08882 |
| SMILES | O=C(/C=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H/b12-11- |
| InChIKey | DQFBYFPFKXHELB-QXMHVHEDSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-chalcone (CHEBI:48966) is a chalcone (CHEBI:27618) |
| IUPAC Name |
|---|
| (2Z)-1,3-diphenylprop-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1210466 | Reaxys |