EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O |
| Net Charge | 0 |
| Average Mass | 208.260 |
| Monoisotopic Mass | 208.08882 |
| SMILES | [H]C(C(=O)c1ccccc1)=C([H])c1ccccc1 |
| InChI | InChI=1S/C15H12O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H |
| InChIKey | DQFBYFPFKXHELB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chalcone (CHEBI:27618) has role plant metabolite (CHEBI:76924) |
| chalcone (CHEBI:27618) is a chalcones (CHEBI:23086) |
| chalcone (CHEBI:27618) is a styrenes (CHEBI:26799) |
| Incoming Relation(s) |
| 2',3,4,4',6'-pentahydroxychalcone (CHEBI:10836) has functional parent chalcone (CHEBI:27618) |
| cis-chalcone (CHEBI:48966) is a chalcone (CHEBI:27618) |
| trans-chalcone (CHEBI:48965) is a chalcone (CHEBI:27618) |
| IUPAC Name |
|---|
| 1,3-diphenylprop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 1,3-Diphenyl-2-propen-1-one | KEGG COMPOUND |
| Benzylideneacetophenone | KEGG COMPOUND |
| Chalcone | KEGG COMPOUND |
| Chalkon | ChEBI |
| styryl phenyl ketone | NIST Chemistry WebBook |
| α-benzylideneacetophenone | NIST Chemistry WebBook |
| Citations |
|---|