EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4878 - ethambutol dihydrochloride
| Formula | C10H26N2O2.2Cl |
| Net Charge | 0 |
| Average Mass | 277.236 |
| Monoisotopic Mass | 276.13713 |
| SMILES | CC[C@@H](CO)[NH2+]CC[NH2+][C@@H](CC)CO.[Cl-].[Cl-] |
| InChI | InChI=1S/C10H24N2O2.2ClH/c1-3-9(7-13)11-5-6-12-10(4-2)8-14;;/h9-14H,3-8H2,1-2H3;2*1H/t9-,10-;;/m0../s1 |
| InChIKey | AUAHHJJRFHRVPV-BZDVOYDHSA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethambutol dihydrochloride (CHEBI:4878) has part ethambutol (CHEBI:4877) |
| ethambutol dihydrochloride (CHEBI:4878) has role antitubercular agent (CHEBI:33231) |
| ethambutol dihydrochloride (CHEBI:4878) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N,N'-bis[(2S)-1-hydroxybutan-2-yl]ethane-1,2-diaminium dichloride |
| Synonyms | Source |
|---|---|
| (+)-2,2'-(ethylenediimino)-di-1-butanol dihydrochloride | ChemIDplus |
| (+)-2,2'-(ethylenediimino)di-1-butanol dihydrochloride | ChEBI |
| (2S,2'E)-2,2'-(ethane-1,2-diyldiimino)dibutan-1-ol dihydrochloride | IUPAC |
| (+)-N,N'-bis(1-(hydroxymethyl)propyl)ethylenediamine dihydrochloride | ChEBI |
| (+)-ethambutol dihydrochloride | ChEBI |
| ethambutol HCl | ChemIDplus |