EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H24N2O2 |
| Net Charge | 0 |
| Average Mass | 204.314 |
| Monoisotopic Mass | 204.18378 |
| SMILES | CC[C@@H](CO)NCCN[C@@H](CC)CO |
| InChI | InChI=1S/C10H24N2O2/c1-3-9(7-13)11-5-6-12-10(4-2)8-14/h9-14H,3-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | AEUTYOVWOVBAKS-UWVGGRQHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethambutol (CHEBI:4877) has role antitubercular agent (CHEBI:33231) |
| ethambutol (CHEBI:4877) has role environmental contaminant (CHEBI:78298) |
| ethambutol (CHEBI:4877) has role xenobiotic (CHEBI:35703) |
| ethambutol (CHEBI:4877) is a ethanolamines (CHEBI:23981) |
| ethambutol (CHEBI:4877) is a ethylenediamine derivative (CHEBI:31577) |
| Incoming Relation(s) |
| ethambutol dihydrochloride (CHEBI:4878) has part ethambutol (CHEBI:4877) |
| IUPAC Name |
|---|
| (2S,2'S)-2,2'-(ethane-1,2-diyldiimino)dibutan-1-ol |
| INNs | Source |
|---|---|
| etambutol | ChemIDplus |
| ethambutol | ChemIDplus |
| ethambutolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+)-2,2'-(ethylenediimino)di-1-butanol | ChemIDplus |
| (2S,7S)-2,7-diethyl-3,6-diazaoctane-1,8-diol | ChEBI |
| EMB | ChEBI |
| (+)-N,N'-bis(1-(hydroxymethyl)propyl)ethylenediamine | ChemIDplus |
| (+)-ethambutol | ChEBI |
| Ethambutol | KEGG COMPOUND |
| Citations |
|---|