EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 440.411 |
| Monoisotopic Mass | 439.16810 |
| SMILES | [H][C@@]12CCc3cc(OC(=O)N(CCCl)CCCl)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C23H31Cl2NO3/c1-23-9-8-18-17-5-3-16(29-22(28)26(12-10-24)13-11-25)14-15(17)2-4-19(18)20(23)6-7-21(23)27/h3,5,14,18-21,27H,2,4,6-13H2,1H3/t18-,19-,20+,21+,23+/m1/s1 |
| InChIKey | FRPJXPJMRWBBIH-RBRWEJTLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Applications: | radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| estramustine (CHEBI:4868) has functional parent 17β-estradiol (CHEBI:16469) |
| estramustine (CHEBI:4868) has role alkylating agent (CHEBI:22333) |
| estramustine (CHEBI:4868) has role antineoplastic agent (CHEBI:35610) |
| estramustine (CHEBI:4868) has role radiation protective agent (CHEBI:66987) |
| estramustine (CHEBI:4868) is a 17β-hydroxy steroid (CHEBI:35343) |
| estramustine (CHEBI:4868) is a carbamate ester (CHEBI:23003) |
| estramustine (CHEBI:4868) is a organochlorine compound (CHEBI:36683) |
| Incoming Relation(s) |
| estramustine phosphate (CHEBI:68643) has functional parent estramustine (CHEBI:4868) |
| IUPAC Name |
|---|
| (17β)-17-hydroxyestra-1(10),2,4-trien-3-yl bis(2-chloroethyl)carbamate |
| INNs | Source |
|---|---|
| estramustina | ChEBI |
| estramustine | ChEBI |
| estramustinum | ChEBI |
| Synonyms | Source |
|---|---|
| 17β-Estradiol 3-(bis(2-chloroethyl)carbamate) | ChemIDplus |
| Estradiol 3-(N,N-bis(2-chloroethyl)carbamate) | ChemIDplus |
| Estramustine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1065 | DrugCentral |
| BE646319 | Patent |
| C11228 | KEGG COMPOUND |
| D04066 | KEGG DRUG |
| DB01196 | DrugBank |
| Estramustine | Wikipedia |
| HMDB0015327 | HMDB |
| LMST02010038 | LIPID MAPS |
| US3299104 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5637599 | Reaxys |
| CAS:2998-57-4 | ChemIDplus |
| Citations |
|---|