EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O |
| Net Charge | 0 |
| Average Mass | 174.203 |
| Monoisotopic Mass | 174.07931 |
| SMILES | O/N=C\Cc1cnc2ccccc12 |
| InChI | InChI=1S/C10H10N2O/c13-12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,6-7,11,13H,5H2/b12-6- |
| InChIKey | ZLIGRGHTISHYNH-SDQBBNPISA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-indol-3-ylacetaldehyde oxime (CHEBI:48577) is a indol-3-ylacetaldehyde oxime (CHEBI:28311) |
| IUPAC Name |
|---|
| N-[(1Z)-2-(1H-indol-3-yl)ethylidene]hydroxylamine |
| Synonyms | Source |
|---|---|
| (1Z)-1H-indol-3-ylacetaldehyde oxime | IUPAC |
| (Z)-indol-3-ylacetaldoxime | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-13028 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7462913 | Reaxys |