EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O |
| Net Charge | 0 |
| Average Mass | 174.203 |
| Monoisotopic Mass | 174.07931 |
| SMILES | ON=CCc1cnc2ccccc12 |
| InChI | InChI=1S/C10H10N2O/c13-12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,6-7,11,13H,5H2 |
| InChIKey | ZLIGRGHTISHYNH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indol-3-ylacetaldehyde oxime (CHEBI:28311) has role plant metabolite (CHEBI:76924) |
| indol-3-ylacetaldehyde oxime (CHEBI:28311) is a aldoxime (CHEBI:22307) |
| indol-3-ylacetaldehyde oxime (CHEBI:28311) is a indoles (CHEBI:24828) |
| Incoming Relation(s) |
| (E)-indol-3-ylacetaldehyde oxime (CHEBI:17545) is a indol-3-ylacetaldehyde oxime (CHEBI:28311) |
| (Z)-indol-3-ylacetaldehyde oxime (CHEBI:48577) is a indol-3-ylacetaldehyde oxime (CHEBI:28311) |
| IUPAC Name |
|---|
| N-[2-(1H-indol-3-yl)ethylidene]hydroxylamine |
| Synonyms | Source |
|---|---|
| 1H-indol-3-ylacetaldehyde oxime | IUPAC |
| IAOx | ChEBI |
| indol-3-ylacetaldoxime | ChEBI |
| indole-3-acetaldehyde oxime | ChemIDplus |
| Indole-3-acetaldoxime | KEGG COMPOUND |
| Citations |
|---|