EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26NO4.Cl |
| Net Charge | 0 |
| Average Mass | 331.840 |
| Monoisotopic Mass | 331.15504 |
| SMILES | COC(=O)CCc1ccc(OCC(O)C[NH2+]C(C)C)cc1.[Cl-] |
| InChI | InChI=1S/C16H25NO4.ClH/c1-12(2)17-10-14(18)11-21-15-7-4-13(5-8-15)6-9-16(19)20-3;/h4-5,7-8,12,14,17-18H,6,9-11H2,1-3H3;1H |
| InChIKey | GEKNCWBANDDJJL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| esmolol hydrochloride (CHEBI:4857) has part esmolol (CHEBI:4856) |
| esmolol hydrochloride (CHEBI:4857) has role anti-arrhythmia drug (CHEBI:38070) |
| esmolol hydrochloride (CHEBI:4857) has role β-adrenergic antagonist (CHEBI:35530) |
| esmolol hydrochloride (CHEBI:4857) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-hydroxy-3-[4-(3-methoxy-3-oxopropyl)phenoxy]-N-(propan-2-yl)propan-1-aminium chloride |
| Synonyms | Source |
|---|---|
| 4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)benzenepropanoic acid methyl ester HCl | ChemIDplus |
| 4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)benzenepropanoic acid methyl ester hydrochloride | ChEBI |
| esmolol HCl | ChemIDplus |
| (±)-esmolol hydrochloride | ChEBI |
| methyl 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoate hydrochloride | IUPAC |
| (±)-methyl p-(2-hydroxy-3-(isopropylamino)propoxy)hydrocinnamate hydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5185568 | Beilstein |
| CAS:81161-17-3 | KEGG DRUG |
| CAS:81161-17-3 | ChemIDplus |
| Citations |
|---|