EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO5 |
| Net Charge | 0 |
| Average Mass | 161.113 |
| Monoisotopic Mass | 161.03242 |
| SMILES | [H]C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H7NO5/c7-2-6-3(5(10)11)1-4(8)9/h2-3H,1H2,(H,6,7)(H,8,9)(H,10,11)/t3-/m0/s1 |
| InChIKey | MQUUQXIFCBBFDP-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formyl-L-aspartic acid (CHEBI:48429) has role mouse metabolite (CHEBI:75771) |
| N-formyl-L-aspartic acid (CHEBI:48429) is a N-acyl-L-aspartic acid (CHEBI:21647) |
| N-formyl-L-aspartic acid (CHEBI:48429) is a N-formyl amino acid (CHEBI:50759) |
| N-formyl-L-aspartic acid (CHEBI:48429) is conjugate acid of N-formyl-L-aspartate(2−) (CHEBI:16923) |
| Incoming Relation(s) |
| N-formyl-L-aspartate(2−) (CHEBI:16923) is conjugate base of N-formyl-L-aspartic acid (CHEBI:48429) |
| IUPAC Names |
|---|
| (2S)-2-(formylamino)butanedioic acid |
| N-formyl-L-aspartic acid |
| Synonym | Source |
|---|---|
| N-Formyl-L-aspartate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725498 | Reaxys |
| CAS:19427-28-2 | KEGG COMPOUND |
| CAS:19427-28-2 | ChemIDplus |
| Citations |
|---|