EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5NO5 |
| Net Charge | -2 |
| Average Mass | 159.097 |
| Monoisotopic Mass | 159.01787 |
| SMILES | [H]C(=O)N[C@@H](CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C5H7NO5/c7-2-6-3(5(10)11)1-4(8)9/h2-3H,1H2,(H,6,7)(H,8,9)(H,10,11)/p-2/t3-/m0/s1 |
| InChIKey | MQUUQXIFCBBFDP-VKHMYHEASA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formyl-L-aspartate(2−) (CHEBI:16923) has functional parent L-aspartate(2−) (CHEBI:29993) |
| N-formyl-L-aspartate(2−) (CHEBI:16923) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N-formyl-L-aspartate(2−) (CHEBI:16923) is a dicarboxylic acid dianion (CHEBI:28965) |
| N-formyl-L-aspartate(2−) (CHEBI:16923) is conjugate base of N-formyl-L-aspartic acid (CHEBI:48429) |
| Incoming Relation(s) |
| N-formyl-L-aspartic acid (CHEBI:48429) is conjugate acid of N-formyl-L-aspartate(2−) (CHEBI:16923) |
| IUPAC Names |
|---|
| (2S)-2-(formylamino)butanedioate |
| N-formyl-L-aspartate |
| UniProt Name | Source |
|---|---|
| N-formyl-L-aspartate | UniProt |
| Citations |
|---|