EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N2O4S.CH4O3S |
| Net Charge | 0 |
| Average Mass | 520.629 |
| Monoisotopic Mass | 520.13379 |
| SMILES | CCCCc1ncc(/C=C(\Cc2cccs2)C(=O)O)n1Cc1ccc(C(=O)O)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C23H24N2O4S.CH4O3S/c1-2-3-6-21-24-14-19(12-18(23(28)29)13-20-5-4-11-30-20)25(21)15-16-7-9-17(10-8-16)22(26)27;1-5(2,3)4/h4-5,7-12,14H,2-3,6,13,15H2,1H3,(H,26,27)(H,28,29);1H3,(H,2,3,4)/b18-12+; |
| InChIKey | DJSLTDBPKHORNY-XMMWENQYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eprosartan methanesulfonate (CHEBI:48409) has part eprosartan (CHEBI:4814) |
| eprosartan methanesulfonate (CHEBI:48409) has role antihypertensive agent (CHEBI:35674) |
| eprosartan methanesulfonate (CHEBI:48409) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| 4-({2-butyl-5-[(1E)-2-carboxy-3-(2-thienyl)prop-1-en-1-yl]-1H-imidazol-1-yl}methyl)benzoic acid methanesulfonate |
| Synonyms | Source |
|---|---|
| eprosartan mesylate | ChemIDplus |
| (E)-2-butyl-1-(p-carboxybenzyl)-α-2-thenylimidazole-5-acrylic acid, monomethanesulfonate | ChemIDplus |
| (E)-α-((2-butyl-1-((4-carboxyphenyl)methyl)-1H-imidazol-5-yl)methylene)-2-thiophenepropanoic acid monomethanesulfonate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Teveten | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02082 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9889741 | Beilstein |
| CAS:144143-96-4 | ChemIDplus |