EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4814 - eprosartan
| Formula | C23H24N2O4S |
| Net Charge | 0 |
| Average Mass | 424.522 |
| Monoisotopic Mass | 424.14568 |
| SMILES | CCCCc1ncc(/C=C(\Cc2cccs2)C(=O)O)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H24N2O4S/c1-2-3-6-21-24-14-19(12-18(23(28)29)13-20-5-4-11-30-20)25(21)15-16-7-9-17(10-8-16)22(26)27/h4-5,7-12,14H,2-3,6,13,15H2,1H3,(H,26,27)(H,28,29)/b18-12+ |
| InChIKey | OROAFUQRIXKEMV-LDADJPATSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| Applications: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. renoprotective agent Any compound that is able to prevent damage to the kidneys. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eprosartan (CHEBI:4814) has role angiotensin receptor antagonist (CHEBI:61016) |
| eprosartan (CHEBI:4814) has role antihypertensive agent (CHEBI:35674) |
| eprosartan (CHEBI:4814) has role antiviral agent (CHEBI:22587) |
| eprosartan (CHEBI:4814) has role cardiovascular drug (CHEBI:35554) |
| eprosartan (CHEBI:4814) has role environmental contaminant (CHEBI:78298) |
| eprosartan (CHEBI:4814) has role renoprotective agent (CHEBI:231911) |
| eprosartan (CHEBI:4814) has role xenobiotic (CHEBI:35703) |
| eprosartan (CHEBI:4814) is a dicarboxylic acid (CHEBI:35692) |
| eprosartan (CHEBI:4814) is a imidazoles (CHEBI:24780) |
| eprosartan (CHEBI:4814) is a thiophenes (CHEBI:26961) |
| Incoming Relation(s) |
| eprosartan methanesulfonate (CHEBI:48409) has part eprosartan (CHEBI:4814) |
| IUPAC Name |
|---|
| 4-({2-butyl-5-[(1E)-2-carboxy-3-(2-thienyl)prop-1-en-1-yl]-1H-imidazol-1-yl}methyl)benzoic acid |
| INN | Source |
|---|---|
| eprosartan | ChemIDplus |
| Synonyms | Source |
|---|---|
| Eprosartan | KEGG COMPOUND |
| (E)-2-butyl-1-(p-carboxybenzyl)-α-2-thenylimidazole-5-acrylic acid | ChemIDplus |
| (E)-3-[2-n-butyl-1-{(4-carboxyphenyl)methyl}-1H-imidazol-5-yl]-2-(2-thienyl)methyl-2-propenoic acid | Patent |
| (E)-α{[2-butyl-1-[(4-carboxyphenyl)methyl]-1H-imidazole-5-yl]methylene}-2-thiopheneproprionic acid | IUPHAR |
| SK-108566 | ChEMBL |
| SK&F 108566 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4338002 | Reaxys |
| CAS:133040-01-4 | KEGG COMPOUND |
| CAS:133040-01-4 | ChemIDplus |
| Citations |
|---|