EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N2O4S |
| Net Charge | 0 |
| Average Mass | 424.522 |
| Monoisotopic Mass | 424.14568 |
| SMILES | CCCCc1ncc(/C=C(\Cc2cccs2)C(=O)O)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H24N2O4S/c1-2-3-6-21-24-14-19(12-18(23(28)29)13-20-5-4-11-30-20)25(21)15-16-7-9-17(10-8-16)22(26)27/h4-5,7-12,14H,2-3,6,13,15H2,1H3,(H,26,27)(H,28,29)/b18-12+ |
| InChIKey | OROAFUQRIXKEMV-LDADJPATSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| Applications: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eprosartan (CHEBI:4814) has role angiotensin receptor antagonist (CHEBI:61016) |
| eprosartan (CHEBI:4814) has role antihypertensive agent (CHEBI:35674) |
| eprosartan (CHEBI:4814) has role environmental contaminant (CHEBI:78298) |
| eprosartan (CHEBI:4814) has role xenobiotic (CHEBI:35703) |
| eprosartan (CHEBI:4814) is a dicarboxylic acid (CHEBI:35692) |
| eprosartan (CHEBI:4814) is a imidazoles (CHEBI:24780) |
| eprosartan (CHEBI:4814) is a thiophenes (CHEBI:26961) |
| Incoming Relation(s) |
| eprosartan methanesulfonate (CHEBI:48409) has part eprosartan (CHEBI:4814) |
| IUPAC Name |
|---|
| 4-({2-butyl-5-[(1E)-2-carboxy-3-(2-thienyl)prop-1-en-1-yl]-1H-imidazol-1-yl}methyl)benzoic acid |
| INN | Source |
|---|---|
| eprosartan | ChemIDplus |
| Synonyms | Source |
|---|---|
| Eprosartan | KEGG COMPOUND |
| (E)-2-butyl-1-(p-carboxybenzyl)-α-2-thenylimidazole-5-acrylic acid | ChemIDplus |
| (E)-3-[2-n-butyl-1-{(4-carboxyphenyl)methyl}-1H-imidazol-5-yl]-2-(2-thienyl)methyl-2-propenoic acid | Patent |
| (E)-α{[2-butyl-1-[(4-carboxyphenyl)methyl]-1H-imidazole-5-yl]methylene}-2-thiopheneproprionic acid | IUPHAR |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4338002 | Reaxys |
| CAS:133040-01-4 | KEGG COMPOUND |
| CAS:133040-01-4 | ChemIDplus |