EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22F3N.HCl |
| Net Charge | 0 |
| Average Mass | 393.880 |
| Monoisotopic Mass | 393.14711 |
| SMILES | C[C@@H](NCCCc1cccc(C(F)(F)F)c1)c1cccc2ccccc12.Cl |
| InChI | InChI=1S/C22H22F3N.ClH/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25;/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | QANQWUQOEJZMLL-PKLMIRHRSA-N |
| Roles Classification |
|---|
| Biological Role: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. |
| Application: | calcimimetic A drug that it mimics the action of calcium on tissues. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinacalcet hydrochloride (CHEBI:48391) has functional parent cinacalcet (CHEBI:48390) |
| cinacalcet hydrochloride (CHEBI:48391) has role calcimimetic (CHEBI:48525) |
| cinacalcet hydrochloride (CHEBI:48391) has role P450 inhibitor (CHEBI:50183) |
| cinacalcet hydrochloride (CHEBI:48391) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N-[(1R)-1-(1-naphthyl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine hydrochloride |
| Synonyms | Source |
|---|---|
| CNC-HCl | Patent |
| Mimpara | ChEBI |
| Sensipar | KEGG DRUG |
| Brand Name | Source |
|---|---|
| SENSIPAR™ | Patent |
| Manual Xrefs | Databases |
|---|---|
| D03505 | KEGG DRUG |
| US2007060645 | Patent |
| WO2010094674 | Patent |
| US2010298606 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10219584 | Reaxys |
| CAS:364782-34-3 | Patent |
| CAS:364782-34-3 | ChemIDplus |
| Citations |
|---|