EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22F3N |
| Net Charge | 0 |
| Average Mass | 357.419 |
| Monoisotopic Mass | 357.17043 |
| SMILES | C[C@@H](NCCCc1cccc(C(F)(F)F)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H22F3N/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3/t16-/m1/s1 |
| InChIKey | VDHAWDNDOKGFTD-MRXNPFEDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. |
| Application: | calcimimetic A drug that it mimics the action of calcium on tissues. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinacalcet (CHEBI:48390) has role calcimimetic (CHEBI:48525) |
| cinacalcet (CHEBI:48390) has role P450 inhibitor (CHEBI:50183) |
| cinacalcet (CHEBI:48390) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| cinacalcet (CHEBI:48390) is a naphthalenes (CHEBI:25477) |
| cinacalcet (CHEBI:48390) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| cinacalcet carbamate (CHEBI:48392) has functional parent cinacalcet (CHEBI:48390) |
| cinacalcet hydrochloride (CHEBI:48391) has functional parent cinacalcet (CHEBI:48390) |
| IUPAC Name |
|---|
| N-[(1R)-1-(1-naphthyl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| INN | Source |
|---|---|
| cinacalcet | ChemIDplus |
| Synonyms | Source |
|---|---|
| CNC | Patent |
| N-((1R)-1-(Naphthalen-1-yl)ethyl)-3-(3-(trifluoromethyl)phenyl)propan-1-amine | ChemIDplus |
| (R)-α-methyl-N-[3-[3-(trifluoromethyl)phenyl]propyl]-1-naphthalenemethane amine | Patent |
| Brand Name | Source |
|---|---|
| Mimpara | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 647 | DrugCentral |
| Cinacalcet | Wikipedia |
| D03504 | KEGG DRUG |
| DB01012 | DrugBank |
| LSM-5815 | LINCS |
| US2007060645 | Patent |
| US6011068 | Patent |
| US6211244 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10191346 | Reaxys |
| CAS:226256-56-0 | ChemIDplus |
| Citations |
|---|