EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10O4 |
| Net Charge | 0 |
| Average Mass | 122.120 |
| Monoisotopic Mass | 122.05791 |
| SMILES | OC[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | UNXHWFMMPAWVPI-QWWZWVQMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (908147) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-threitol (CHEBI:48300) has role human metabolite (CHEBI:77746) |
| D-threitol (CHEBI:48300) is a threitol (CHEBI:26981) |
| D-threitol (CHEBI:48300) is enantiomer of L-threitol (CHEBI:42090) |
| Incoming Relation(s) |
| L-threitol (CHEBI:42090) is enantiomer of D-threitol (CHEBI:48300) |
| IUPAC Name |
|---|
| (2R,3R)-butane-1,2,3,4-tetrol |
| Synonym | Source |
|---|---|
| D-threo-tetritol | IUPAC |
| UniProt Name | Source |
|---|---|
| D-threitol | UniProt |
| Citations |
|---|