EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:42090 - L-threitol
| Formula | C4H10O4 |
| Net Charge | 0 |
| Average Mass | 122.120 |
| Monoisotopic Mass | 122.05791 |
| SMILES | OC[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | UNXHWFMMPAWVPI-IMJSIDKUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-threitol (CHEBI:42090) has role algal metabolite (CHEBI:84735) |
| L-threitol (CHEBI:42090) is a threitol (CHEBI:26981) |
| L-threitol (CHEBI:42090) is enantiomer of D-threitol (CHEBI:48300) |
| Incoming Relation(s) |
| D-threitol (CHEBI:48300) is enantiomer of L-threitol (CHEBI:42090) |
| IUPAC Name |
|---|
| (2S,3S)-butane-1,2,3,4-tetrol |
| Synonyms | Source |
|---|---|
| D-TREITOL | PDBeChem |
| L-threo-tetritol | IUPAC |
| UniProt Name | Source |
|---|---|
| L-threitol | UniProt |
| Citations |
|---|