EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48282 - 5-methoxy-N,N-diisopropyltryptamine
| Formula | C17H26N2O |
| Net Charge | 0 |
| Average Mass | 274.408 |
| Monoisotopic Mass | 274.20451 |
| SMILES | COc1ccc2ncc(CCN(C(C)C)C(C)C)c2c1 |
| InChI | InChI=1S/C17H26N2O/c1-12(2)19(13(3)4)9-8-14-11-18-17-7-6-15(20-5)10-16(14)17/h6-7,10-13,18H,8-9H2,1-5H3 |
| InChIKey | DNBPMBJFRRVTSJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methoxy-N,N-diisopropyltryptamine (CHEBI:48282) has functional parent N,N-diisopropyltryptamine (CHEBI:48286) |
| 5-methoxy-N,N-diisopropyltryptamine (CHEBI:48282) has functional parent 5-methoxytryptamine (CHEBI:2089) |
| 5-methoxy-N,N-diisopropyltryptamine (CHEBI:48282) has role hallucinogen (CHEBI:35499) |
| 5-methoxy-N,N-diisopropyltryptamine (CHEBI:48282) is a tryptamines (CHEBI:27162) |
| IUPAC Name |
|---|
| N-{2-[5-(methyloxy)-1H-indol-3-yl]ethyl}-N-(propan-2-yl)propan-2-amine |
| Synonyms | Source |
|---|---|
| 5-methoxy-N,N-bis(1-methylethyl)-1H-indole-3-ethanamine | DrugBank |
| N-(1-methylethyl)-N-{2-[5-(methyloxy)-1H-indol-3-yl]ethyl}propan-2-amine | IUPAC |
| N-isopropyl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]propan-2-amine | IUPAC |
| 5-MeO-DIPT | DrugBank |