EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O2S |
| Net Charge | 0 |
| Average Mass | 229.305 |
| Monoisotopic Mass | 229.08850 |
| SMILES | C[N+](C)(C)[C@@H](Cc1cnc(S)n1)C(=O)[O-] |
| InChI | InChI=1S/C9H15N3O2S/c1-12(2,3)7(8(13)14)4-6-5-10-9(15)11-6/h5,7H,4H2,1-3H3,(H2-,10,11,13,14,15)/t7-/m0/s1 |
| InChIKey | SSISHJJTAXXQAX-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coprinus comatus (ncbitaxon:56187) | - | PubMed (26338495) | |
| Mycobacterium tuberculosis (ncbitaxon:1773) | - | PubMed (26774486) | |
| Pleurotus ostreatus (ncbitaxon:5322) | - | PubMed (27134772) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergothioneine (CHEBI:4828) has role antioxidant (CHEBI:22586) |
| ergothioneine (CHEBI:4828) has role chelator (CHEBI:38161) |
| ergothioneine (CHEBI:4828) has role fungal metabolite (CHEBI:76946) |
| ergothioneine (CHEBI:4828) has role plant metabolite (CHEBI:76924) |
| ergothioneine (CHEBI:4828) has role xenobiotic metabolite (CHEBI:76206) |
| ergothioneine (CHEBI:4828) is a L-histidine derivative (CHEBI:84076) |
| ergothioneine (CHEBI:4828) is a amino-acid betaine (CHEBI:22860) |
| ergothioneine (CHEBI:4828) is a sulfur-containing amino acid (CHEBI:26834) |
| ergothioneine (CHEBI:4828) is conjugate base of ergothioneine(1+) (CHEBI:134344) |
| ergothioneine (CHEBI:4828) is tautomer of ergothioneine thione form (CHEBI:82707) |
| Incoming Relation(s) |
| S-methyl-L-ergothioneine (CHEBI:76620) has functional parent ergothioneine (CHEBI:4828) |
| 2-sulfenohercynine (CHEBI:136834) has functional parent ergothioneine (CHEBI:4828) |
| ergothioneine(1+) (CHEBI:134344) is conjugate acid of ergothioneine (CHEBI:4828) |
| ergothioneine thione form (CHEBI:82707) is tautomer of ergothioneine (CHEBI:4828) |
| IUPAC Name |
|---|
| (2S)-3-(2-mercapto-1H-imidazol-5-yl)-2-(trimethylazaniumyl)propanoate |
| Synonyms | Source |
|---|---|
| (2S)-3-(2-mercapto-1H-imidazol-5-yl)-2-(trimethylammonio)propanoate | ChEBI |
| 2-mercaptohistidine trimethylbetaine | ChEBI |
| 3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)-2-trimethylammonio-propanoate | ChEBI |
| ergothionine | ChemIDplus |
| erythrothioneine | ChEBI |
| (S)-(1-carboxy-2-(2-mercaptoimidazol-4-yl)ethyl)trimethylammonium hydroxide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05570 | KEGG COMPOUND |
| CPD-15276 | MetaCyc |
| Ergothioneine | Wikipedia |
| HMDB0003045 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5755696 | Reaxys |
| Reaxys:8411606 | Reaxys |
| CAS:497-30-3 | ChemIDplus |
| CAS:497-30-3 | KEGG COMPOUND |
| Citations |
|---|