EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N3O2S |
| Net Charge | +1 |
| Average Mass | 230.313 |
| Monoisotopic Mass | 230.09577 |
| SMILES | C[N+](C)(C)[C@@H](Cc1cnc(S)[nH+]1)C(=O)[O-] |
| InChI | InChI=1S/C9H15N3O2S/c1-12(2,3)7(8(13)14)4-6-5-10-9(15)11-6/h5,7H,4H2,1-3H3,(H2-,10,11,13,14,15)/p+1/t7-/m0/s1 |
| InChIKey | SSISHJJTAXXQAX-ZETCQYMHSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergothioneine(1+) (CHEBI:134344) is a α-amino-acid cation (CHEBI:33719) |
| ergothioneine(1+) (CHEBI:134344) is conjugate acid of ergothioneine (CHEBI:4828) |
| Incoming Relation(s) |
| ergothioneine (CHEBI:4828) is conjugate base of ergothioneine(1+) (CHEBI:134344) |
| IUPAC Name |
|---|
| (2S)-3-(2-sulfanylidene-2,3-dihydro-1H-imidazol-3-ium-4-yl)-2-(trimethylazaniumyl)propanoate |
| Synonym | Source |
|---|---|
| ergothioneine cation | ChEBI |
| UniProt Name | Source |
|---|---|
| ergothioneine | UniProt |